cas: 21872-32-2 — see every product listed under this CAS number, including other names
(S)-(1-Isocyanoethyl)benzene 96% (CAS 21872-32-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1388541-100mg |
| cas | 21872-32-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1115.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1388541 |
[(1S)-1-isocyanoethyl]benzene (CAS 21872-32-2) is a chemical compound with the molecular formula C9H9N and a molecular weight of 131.17 g/mol. IUPAC name: [(1S)-1-isocyanoethyl]benzene. InChIKey: KCCAPMXVCPVFEH-QMMMGPOBSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 131.17 g/mol |
| IUPAC name | [(1S)-1-isocyanoethyl]benzene |
| InChIKey | KCCAPMXVCPVFEH-QMMMGPOBSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)[N+]#[C-] |
Computed by PubChem (NCBI)