CAS 2769-71-3 appears in our catalog under these names: 2,6-Dimethylphenyl isocyanide, 96%, 2,6-Dimethylphenyl isocyanide , 2-Isocyano-1,3-dimethyl-benzene, 2,6-DIMETHYLPHENYL ISOCYANIDE, >=98.0 &, Benzene, 2-isocyano-1,3-dimethyl-, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 2,5g, 250mg.
2-isocyano-1,3-dimethylbenzene (CAS 2769-71-3) is a chemical compound with the molecular formula C9H9N and a molecular weight of 131.17 g/mol. IUPAC name: 2-isocyano-1,3-dimethylbenzene. InChIKey: DNJLFZHMJDSJFN-UHFFFAOYSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 131.17 g/mol |
| IUPAC name | 2-isocyano-1,3-dimethylbenzene |
| InChIKey | DNJLFZHMJDSJFN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)[N+]#[C-] |
Computed by PubChem (NCBI)