cas: 176022-47-2 — see every product listed under this CAS number, including other names
(S)-(4-Chlorophenyl)(pyridin-2-yl)methanol, 98% (CAS 176022-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689966-100MG |
| cas | 176022-47-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1164.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(S)-(4-chlorophenyl)-pyridin-2-ylmethanol (CAS 176022-47-2) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: (S)-(4-chlorophenyl)-pyridin-2-ylmethanol. InChIKey: ZFUPOFQRQNJDNS-LBPRGKRZSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (S)-(4-chlorophenyl)-pyridin-2-ylmethanol |
| InChIKey | ZFUPOFQRQNJDNS-LBPRGKRZSA-N |
| SMILES | C1=CC=NC(=C1)[C@H](C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)