CAS 182556-72-5 appears in our catalog under these names: 4-(Benzyloxy)-2-chloropyridine, 97%, 4-(benzyloxy)-2-chloropyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g, 2,5g.
2-chloro-4-phenylmethoxypyridine (CAS 182556-72-5) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 2-chloro-4-phenylmethoxypyridine. InChIKey: XZLZQERVHJHMAL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2-chloro-4-phenylmethoxypyridine |
| InChIKey | XZLZQERVHJHMAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)