(S)-[1,3':1',1'':3'',1'''-Quaternaphthalene]-2',2''-diol, 97%
cas: 863659-88-5 — see every product listed under this CAS number, including other names
(S)-[1,3':1',1'':3'',1'''-Quaternaphthalene]-2',2''-diol, 97% (CAS 863659-88-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3YW-50mg |
| cas | 863659-88-5 |
| size | 50mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 2584.40 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 3225.97 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 310.32 Pln | |
| Fluorochem | 1g | 955.93 Pln | |
| Fluorochem | 5g | 3580.01 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2-hydroxy-3-naphthalen-1-ylnaphthalen-1-yl)-3-naphthalen-1-ylnaphthalen-2-ol (CAS 863659-88-5) is a chemical compound with the molecular formula C40H26O2 and a molecular weight of 538.6 g/mol. IUPAC name: 1-(2-hydroxy-3-naphthalen-1-ylnaphthalen-1-yl)-3-naphthalen-1-ylnaphthalen-2-ol. InChIKey: FRYNHLQJUJCRFB-UHFFFAOYSA-N.
| Molecular formula | C40H26O2 |
|---|---|
| Molecular weight | 538.6 g/mol |
| IUPAC name | 1-(2-hydroxy-3-naphthalen-1-ylnaphthalen-1-yl)-3-naphthalen-1-ylnaphthalen-2-ol |
| InChIKey | FRYNHLQJUJCRFB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=CC4=CC=CC=C4C(=C3O)C5=C(C(=CC6=CC=CC=C65)C7=CC=CC8=CC=CC=C87)O |
Computed by PubChem (NCBI)