(S)-1,1'-Binaphthyl-2,2'-disulfonamide, 95%
cas: 1245748-66-6 — see every product listed under this CAS number, including other names
(S)-1,1'-Binaphthyl-2,2'-disulfonamide, 95% (CAS 1245748-66-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A312396-100mg |
| cas | 1245748-66-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 570.62 Pln | |
| Ambeed | 250mg | 1076.81 Pln | |
| Ambeed | 1g | 3418.62 Pln | |
| Ambeed | 5g | 11890.31 Pln | |
| Chemat | 100mg | 482.00 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2848.40 Pln | |
| BLDpharm | 100mg | 614.25 Pln | |
| BLDpharm | 250mg | 1152.95 Pln | |
| BLDpharm | 1g | 3679.84 Pln | |
| BLDpharm | 5g | 12815.51 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide (CAS 1245748-66-6) is a chemical compound with the molecular formula C20H16N2O4S2 and a molecular weight of 412.5 g/mol. IUPAC name: 1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide. InChIKey: GHOMEMIQVSTVEP-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4S2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide |
| InChIKey | GHOMEMIQVSTVEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S(=O)(=O)N)S(=O)(=O)N |
Computed by PubChem (NCBI)