CAS 1187629-41-9 appears in our catalog under these names: (R)-1,1′-Binaphthyl-2,2′-disulfonimide, (R)–1,1'–Binaphthalene–2,2'–sulfonimide, (R)-1,1'-Binaphthyl-2,2'-disulfonamide 95%, (R)-1,1'-BINAPHTHYL-2,2'-DISULFONIMIDE,&, (R)-1,1'-Binaphthyl-2,2'-disulfonamide, 95%, 95%. Offered by: TRC, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide (CAS 1187629-41-9) is a chemical compound with the molecular formula C20H16N2O4S2 and a molecular weight of 412.5 g/mol. IUPAC name: 1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide. InChIKey: GHOMEMIQVSTVEP-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4S2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 1-(2-sulfamoylnaphthalen-1-yl)naphthalene-2-sulfonamide |
| InChIKey | GHOMEMIQVSTVEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)S(=O)(=O)N)S(=O)(=O)N |
Computed by PubChem (NCBI)