cas: 736127-08-5 — see every product listed under this CAS number, including other names
(S)-1,1,1-Trifluoro-3,3-dimethylbutan-2-amine 97% (CAS 736127-08-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A345934-100mg |
| cas | 736127-08-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 687.44 Pln | |
| Ambeed | 250mg | 815.38 Pln | |
| Ambeed | 1g | 1583.00 Pln | |
| Ambeed | 5g | 7635.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A345934 |
(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine (CAS 736127-08-5) is a chemical compound with the molecular formula C6H12F3N and a molecular weight of 155.16 g/mol. IUPAC name: (2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine. InChIKey: SWDHBAMNSWXENT-BYPYZUCNSA-N.
| Molecular formula | C6H12F3N |
|---|---|
| Molecular weight | 155.16 g/mol |
| IUPAC name | (2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine |
| InChIKey | SWDHBAMNSWXENT-BYPYZUCNSA-N |
| SMILES | CC(C)(C)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)