CAS 736127-08-5 appears in our catalog under these names: (S)-2,2-Dimethyl-1-trifluoromethyl-propylamine, 97%, (S)-1,1,1-Trifluoro-3,3-dimethylbutan-2-amine 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine (CAS 736127-08-5) is a chemical compound with the molecular formula C6H12F3N and a molecular weight of 155.16 g/mol. IUPAC name: (2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine. InChIKey: SWDHBAMNSWXENT-BYPYZUCNSA-N.
| Molecular formula | C6H12F3N |
|---|---|
| Molecular weight | 155.16 g/mol |
| IUPAC name | (2S)-1,1,1-trifluoro-3,3-dimethylbutan-2-amine |
| InChIKey | SWDHBAMNSWXENT-BYPYZUCNSA-N |
| SMILES | CC(C)(C)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)