cas: 195202-09-6 — see every product listed under this CAS number, including other names
(S)-1-((S)-2-(3,4,5-Trimethoxyphenyl)butanoyl)piperidine-2-carboxylic acid, 98%, 98% (CAS 195202-09-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V7HI-1mg |
| cas | 195202-09-6 |
| size | 1mg |
| availability | 150g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 131.60 Pln | |
| Chemat | 10mg | 170.00 Pln | |
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 995.60 Pln | |
| Chemat | 1g | 1562.00 Pln | |
| Chemat | 5g | 2896.40 Pln | |
| Chemat | 10g | 3774.80 Pln | |
| Chemat | 25g | 7490.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidine-2-carboxylic acid (CAS 195202-09-6) is a chemical compound with the molecular formula C19H27NO6 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidine-2-carboxylic acid. InChIKey: QSLGUZZUFDIKSY-KBPBESRZSA-N.
| Molecular formula | C19H27NO6 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidine-2-carboxylic acid |
| InChIKey | QSLGUZZUFDIKSY-KBPBESRZSA-N |
| SMILES | CC[C@@H](C1=CC(=C(C(=C1)OC)OC)OC)C(=O)N2CCCC[C@H]2C(=O)O |
Computed by PubChem (NCBI)