CAS 1807521-09-0 appears in our catalog under these names: Ald-ph-peg2-t-butyl ester, 95%, Ald–Ph–amido–PEG2–C2–Boc, tert-Butyl 3-(2-(2-(4-formylbenzamido)ethoxy)ethoxy)propanoate, 97%, 97%, Ald-Ph-amido-PEG2-C2-Boc, 97.0%, Ald-Ph-amido-PEG2-C2-Boc, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 1g, 100 mg, 25 mg, 50 mg.
Tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate (CAS 1807521-09-0) is a chemical compound with the molecular formula C19H27NO6 and a molecular weight of 365.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate. InChIKey: UXMPBIQFYCJYBB-UHFFFAOYSA-N.
| Molecular formula | C19H27NO6 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate |
| InChIKey | UXMPBIQFYCJYBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNC(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)