cas: 755025-16-2 — see every product listed under this CAS number, including other names
(S)-1-(2,4-Dimethoxybenzyl)-5-oxopyrrolidine-3-carboxylic acid, 97%, 97% (CAS 755025-16-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICN1-500mg |
| cas | 755025-16-2 |
| size | 500mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 621.20 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2848.40 Pln | |
| Chemat | 10g | 4706.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid (CAS 755025-16-2) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (3S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid. InChIKey: OZFGRQLUQFPWPR-JTQLQIEISA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (3S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | OZFGRQLUQFPWPR-JTQLQIEISA-N |
| SMILES | COC1=CC(=C(C=C1)CN2C[C@H](CC2=O)C(=O)O)OC |
Computed by PubChem (NCBI)