cas: 127852-21-5 — see every product listed under this CAS number, including other names
(S)-1-(3-(Trifluoromethyl)phenyl)ethanamine, 97% (CAS 127852-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210065-100MG |
| cas | 127852-21-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 1028.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1S)-1-[3-(trifluoromethyl)phenyl]ethanamine (CAS 127852-21-5) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: (1S)-1-[3-(trifluoromethyl)phenyl]ethanamine. InChIKey: ODZXRBRYQGYVJY-LURJTMIESA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | (1S)-1-[3-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | ODZXRBRYQGYVJY-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)