CAS 2007909-20-6 appears in our catalog under these names: 3,4-Dimethyl-5-(trifluoromethyl)benzenamine, 95%, 3,4-Dimethyl-5-(trifluoromethyl)aniline, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g.
3,4-dimethyl-5-(trifluoromethyl)aniline (CAS 2007909-20-6) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: 3,4-dimethyl-5-(trifluoromethyl)aniline. InChIKey: PBGMSCAGPWRIJS-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | 3,4-dimethyl-5-(trifluoromethyl)aniline |
| InChIKey | PBGMSCAGPWRIJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)C(F)(F)F)N |
Computed by PubChem (NCBI)