cas: 625095-57-0 — see every product listed under this CAS number, including other names
(S)-1-(3-Chlorophenyl)propane-1,3-diol, 97%, 97% (CAS 625095-57-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EL3B-100mg |
| cas | 625095-57-0 |
| size | 100mg |
| availability | 82g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 496.40 Pln | |
| Chemat | 10g | 923.60 Pln | |
| Chemat | 25g | 1888.40 Pln | |
| Chemat | 50g | 3165.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(3-chlorophenyl)propane-1,3-diol (CAS 625095-57-0) is a chemical compound with the molecular formula C9H11ClO2 and a molecular weight of 186.63 g/mol. IUPAC name: (1S)-1-(3-chlorophenyl)propane-1,3-diol. InChIKey: VJGRFGFLZJIODS-VIFPVBQESA-N.
| Molecular formula | C9H11ClO2 |
|---|---|
| Molecular weight | 186.63 g/mol |
| IUPAC name | (1S)-1-(3-chlorophenyl)propane-1,3-diol |
| InChIKey | VJGRFGFLZJIODS-VIFPVBQESA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CCO)O |
Computed by PubChem (NCBI)