Products 625095-57-0
CAS 625095-57-0 appears in our catalog under these names: (S)-1-(3-Chlorophenyl)propane-1,3-diol, 95%, (S)-1-(3-chlorophenyl)propane-1,3-diol, (S)-1-(3-Chlorophenyl)propane-1,3-diol 97%, (S)-1-(3-Chlorophenyl)propane-1,3-diol, 97%, 97%, (S)-1-(3-Chlorophenyl)propane-1,3-diol, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 100g, 25g, 100mg, 50g.
(1S)-1-(3-chlorophenyl)propane-1,3-diol (CAS 625095-57-0) is a chemical compound with the molecular formula C9H11ClO2 and a molecular weight of 186.63 g/mol. IUPAC name: (1S)-1-(3-chlorophenyl)propane-1,3-diol. InChIKey: VJGRFGFLZJIODS-VIFPVBQESA-N.
| Molecular formula | C9H11ClO2 |
|---|---|
| Molecular weight | 186.63 g/mol |
| IUPAC name | (1S)-1-(3-chlorophenyl)propane-1,3-diol |
| InChIKey | VJGRFGFLZJIODS-VIFPVBQESA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CCO)O |
Computed by PubChem (NCBI)