cas: 84499-72-9 — see every product listed under this CAS number, including other names
(S)-1-(p-Tolyl)ethanamine hydrochloride, 98%, 98% (CAS 84499-72-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8E1-100mg |
| cas | 84499-72-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1629.20 Pln | |
| Chemat | 25g | 5459.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(4-methylphenyl)ethanamine;hydrochloride (CAS 84499-72-9) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: (1S)-1-(4-methylphenyl)ethanamine;hydrochloride. InChIKey: QDWBCLYSNFCQGQ-QRPNPIFTSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 171.67 g/mol |
| IUPAC name | (1S)-1-(4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | QDWBCLYSNFCQGQ-QRPNPIFTSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C)N.Cl |
Computed by PubChem (NCBI)