CAS 84499-72-9 appears in our catalog under these names: (S)-1-(P-Tolyl)ethanamine hydrochloride, 95%, (S)–1–(p–Tolyl)ethanamine hydrochloride, (S)-1-(p-Tolyl)ethanamine HCl, (S)-1-(p-Tolyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(p-Tolyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g, 25g, 2.5g.
(1S)-1-(4-methylphenyl)ethanamine;hydrochloride (CAS 84499-72-9) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: (1S)-1-(4-methylphenyl)ethanamine;hydrochloride. InChIKey: QDWBCLYSNFCQGQ-QRPNPIFTSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 171.67 g/mol |
| IUPAC name | (1S)-1-(4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | QDWBCLYSNFCQGQ-QRPNPIFTSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H](C)N.Cl |
Computed by PubChem (NCBI)