cas: 198646-60-5 — see every product listed under this CAS number, including other names
(S)-1-(tert-Butoxycarbonyl)-4-oxopiperidine-2-carboxylic acid 97% (CAS 198646-60-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122674-250mg |
| cas | 198646-60-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 898.81 Pln | |
| Ambeed | 100g | 3068.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122674 |
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid (CAS 198646-60-5) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid. InChIKey: GPBCBXYUAJQMQM-QMMMGPOBSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxopiperidine-2-carboxylic acid |
| InChIKey | GPBCBXYUAJQMQM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C[C@H]1C(=O)O |
Computed by PubChem (NCBI)