Products 936497-91-5

CAS 936497-91-5 is the registry number for 1-Boc-3-oxo-isonipecotic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopiperidine-4-carboxylic acid (CAS 936497-91-5) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopiperidine-4-carboxylic acid. InChIKey: WXVSVABCXJRJKT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO5
Molecular weight243.26 g/mol
IUPAC name1-[(2-methylpropan-2-yl)oxycarbonyl]-3-oxopiperidine-4-carboxylic acid
InChIKeyWXVSVABCXJRJKT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C(=O)C1)C(=O)O

Computed by PubChem (NCBI)