cas: 923565-98-4 — see every product listed under this CAS number, including other names
(S)-1-Cbz-2-Methylpiperazine 98% (CAS 923565-98-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A590805-1g |
| cas | 923565-98-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 748.62 Pln | |
| Ambeed | 25g | 2795.62 Pln | |
| Ambeed | 100g | 8786.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A590805 |
Benzyl (2S)-2-methylpiperazine-1-carboxylate (CAS 923565-98-4) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (2S)-2-methylpiperazine-1-carboxylate. InChIKey: KKBYAYOFCRJQQT-NSHDSACASA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (2S)-2-methylpiperazine-1-carboxylate |
| InChIKey | KKBYAYOFCRJQQT-NSHDSACASA-N |
| SMILES | C[C@H]1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)