cas: 876379-22-5 — see every product listed under this CAS number, including other names
(S)-1-Cbz-3-Boc-Aminopiperidine, 95%, 95% (CAS 876379-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115ONJ-100mg |
| cas | 876379-22-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 952.40 Pln | |
| Chemat | 5g | 3741.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (CAS 876379-22-5) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate. InChIKey: SIONIIVXRCVHFL-HNNXBMFYSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | benzyl (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| InChIKey | SIONIIVXRCVHFL-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(C1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)