Products 502649-21-0

CAS 502649-21-0 is the registry number for 1-Benzyl 4-tert-butyl 2-methylpiperazine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-benzyl 4-O-tert-butyl 2-methylpiperazine-1,4-dicarboxylate (CAS 502649-21-0) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl 2-methylpiperazine-1,4-dicarboxylate. InChIKey: HNSFFEBZXFRVSE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H26N2O4
Molecular weight334.4 g/mol
IUPAC name1-O-benzyl 4-O-tert-butyl 2-methylpiperazine-1,4-dicarboxylate
InChIKeyHNSFFEBZXFRVSE-UHFFFAOYSA-N
SMILESCC1CN(CCN1C(=O)OCC2=CC=CC=C2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)