cas: 30339-30-1 — see every product listed under this CAS number, including other names
(S)-1-Phenyl-2-(p-tolyl)ethanamine, ≥98%, ≥98% (CAS 30339-30-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZS7-200mg |
| cas | 30339-30-1 |
| size | 200mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 141.20 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 990.80 Pln | |
| Chemat | 25g | 2978.00 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(1S)-2-(4-methylphenyl)-1-phenylethanamine (CAS 30339-30-1) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (1S)-2-(4-methylphenyl)-1-phenylethanamine. InChIKey: ZICDZTXDTPZBKH-HNNXBMFYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (1S)-2-(4-methylphenyl)-1-phenylethanamine |
| InChIKey | ZICDZTXDTPZBKH-HNNXBMFYSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C2=CC=CC=C2)N |
Computed by PubChem (NCBI)