CAS 94026-73-0 appears in our catalog under these names: 2,4,4'-Trimethyldiphenylamine, 95%, 2,4-Dimethyl-N-(p-tolyl)aniline, 97%, 2,4–dimethyl–N–(4–methylphenyl)aniline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg.
2,4-dimethyl-N-(4-methylphenyl)aniline (CAS 94026-73-0) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: 2,4-dimethyl-N-(4-methylphenyl)aniline. InChIKey: LAQZTCAFWPQEQO-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | 2,4-dimethyl-N-(4-methylphenyl)aniline |
| InChIKey | LAQZTCAFWPQEQO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=C(C=C2)C)C |
Computed by PubChem (NCBI)