cas: 62197-94-8 — see every product listed under this CAS number, including other names
(S)-2,2,2-Trifluoro-1-phenyl-ethylamine, 97% (CAS 62197-94-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044273-100MG |
| cas | 62197-94-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 1330.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-2,2,2-trifluoro-1-phenylethanamine (CAS 62197-94-8) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-phenylethanamine. InChIKey: DZCAUMADOBDJJH-ZETCQYMHSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-phenylethanamine |
| InChIKey | DZCAUMADOBDJJH-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)