CAS 57631-04-6 appears in our catalog under these names: 2-(2,2,2-Trifluoroethyl)aniline, 95%, 2-(2,2,2-Trifluoroethyl)aniline, 97%, 2–(2,2,2–Trifluoroethyl)aniline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(2,2,2-trifluoroethyl)aniline (CAS 57631-04-6) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethyl)aniline. InChIKey: OESMBUMMTXSJRB-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethyl)aniline |
| InChIKey | OESMBUMMTXSJRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(F)(F)F)N |
Computed by PubChem (NCBI)