cas: 62197-94-8 — see every product listed under this CAS number, including other names
(S)-2,2,2-Trifluoro-1-phenylethanamine 96% (CAS 62197-94-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A742300-100mg |
| cas | 62197-94-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 1405.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A742300 |
(1S)-2,2,2-trifluoro-1-phenylethanamine (CAS 62197-94-8) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-phenylethanamine. InChIKey: DZCAUMADOBDJJH-ZETCQYMHSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-phenylethanamine |
| InChIKey | DZCAUMADOBDJJH-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)