cas: 119798-08-2 — see every product listed under this CAS number, including other names
(S)-2,5-bis((tert-Butoxycarbonyl)(3-((tert-butoxycarbonyl)amino)propyl)amino)pentanoic acid, 98%, 98% (CAS 119798-08-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PNO-5g |
| cas | 119798-08-2 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 14238.80 Pln | |
| Chemat | 100mg | 765.20 Pln | |
| Chemat | 250mg | 1259.60 Pln | |
| Chemat | 1g | 3606.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoic acid (CAS 119798-08-2) is a chemical compound with the molecular formula C31H58N4O10 and a molecular weight of 646.8 g/mol. IUPAC name: (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoic acid. InChIKey: HSPKBBVFWXCYJN-QFIPXVFZSA-N.
| Molecular formula | C31H58N4O10 |
|---|---|
| Molecular weight | 646.8 g/mol |
| IUPAC name | (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoic acid |
| InChIKey | HSPKBBVFWXCYJN-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCC[C@@H](C(=O)O)N(CCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)