cas: 119798-08-2 — see every product listed under this CAS number, including other names
Boc4-Sper-COOH 95% (CAS 119798-08-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A748538-100mg |
| cas | 119798-08-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1115.75 Pln | |
| Ambeed | 250mg | 1694.25 Pln | |
| Ambeed | 1g | 4781.44 Pln | |
| Ambeed | 5g | 18926.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A748538 |
(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoic acid (CAS 119798-08-2) is a chemical compound with the molecular formula C31H58N4O10 and a molecular weight of 646.8 g/mol. IUPAC name: (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoic acid. InChIKey: HSPKBBVFWXCYJN-QFIPXVFZSA-N.
| Molecular formula | C31H58N4O10 |
|---|---|
| Molecular weight | 646.8 g/mol |
| IUPAC name | (2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]pentanoic acid |
| InChIKey | HSPKBBVFWXCYJN-QFIPXVFZSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCC[C@@H](C(=O)O)N(CCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)