cas: 2444356-85-6 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-5-(allyloxy)-5-oxopentanoic acid, 98%, 98% (CAS 2444356-85-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KVNM-25g |
| cas | 2444356-85-6 |
| size | 25g |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 3851.60 Pln | |
| Chemat | 50g | 5574.80 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 1782.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-oxo-5-prop-2-enoxypentanoic acid (CAS 2444356-85-6) is a chemical compound with the molecular formula C24H25NO6 and a molecular weight of 423.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-oxo-5-prop-2-enoxypentanoic acid. InChIKey: QHGCJBFSYCTXGI-NRFANRHFSA-N.
| Molecular formula | C24H25NO6 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-oxo-5-prop-2-enoxypentanoic acid |
| InChIKey | QHGCJBFSYCTXGI-NRFANRHFSA-N |
| SMILES | CN([C@@H](CCC(=O)OCC=C)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)