CAS 2741190-31-6 appears in our catalog under these names: Coumarin–Quinone Conjugate, Coumarin–quinone conjugate, 99.9%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 1 mg, 500 μg.
(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 7-(diethylamino)-2-oxochromene-3-carboxylate (CAS 2741190-31-6) is a chemical compound with the molecular formula C24H25NO6 and a molecular weight of 423.5 g/mol. IUPAC name: (2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 7-(diethylamino)-2-oxochromene-3-carboxylate. InChIKey: QJCBHBXUOMJXSQ-UHFFFAOYSA-N.
| Molecular formula | C24H25NO6 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | (2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methyl 7-(diethylamino)-2-oxochromene-3-carboxylate |
| InChIKey | QJCBHBXUOMJXSQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)OCC3=C(C(=O)C(=C(C3=O)C)C)C |
Computed by PubChem (NCBI)