cas: 247127-51-1 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-((1-(4,4-dimethyl-2,6-dioxocyclohexylidene)ethyl)amino)propanoic acid, 98% (CAS 247127-51-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113P73-100mg |
| cas | 247127-51-1 |
| size | 100mg |
| availability | 99g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1888.40 Pln | |
| Chemat | 50g | 3371.60 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 1039.24 Pln | |
| Fluorochem | 10g | 1684.84 Pln | |
| Fluorochem | 25g | 3366.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propanoic acid (CAS 247127-51-1) is a chemical compound with the molecular formula C28H30N2O6 and a molecular weight of 490.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propanoic acid. InChIKey: GIPBZQFNSMWQIL-QFIPXVFZSA-N.
| Molecular formula | C28H30N2O6 |
|---|---|
| Molecular weight | 490.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]propanoic acid |
| InChIKey | GIPBZQFNSMWQIL-QFIPXVFZSA-N |
| SMILES | CC(=NC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C4=C(CC(CC4=O)(C)C)O |
Computed by PubChem (NCBI)