(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-(tert-butoxycarbonyl)phenyl)propanoic acid, 98%
cas: 210282-33-0 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-(tert-butoxycarbonyl)phenyl)propanoic acid, 98% (CAS 210282-33-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 50g, 250g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01394366-100mg |
| cas | 210282-33-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 100mg | 447.64 Pln | |
| BLDpharm | 250mg | 703.11 Pln | |
| BLDpharm | 1g | 1747.19 Pln | |
| BLDpharm | 5g | 5273.72 Pln | |
| BLDpharm | 25g | 15475.69 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1163.60 Pln | |
| Chemat | 25g | 2474.00 Pln | |
| Chemat | 50g | 4197.20 Pln | |
| Chemat | 250g | 15410.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]propanoic acid (CAS 210282-33-0) is a chemical compound with the molecular formula C29H29NO6 and a molecular weight of 487.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]propanoic acid. InChIKey: XHBQLWKTRQMTPQ-VWLOTQADSA-N.
| Molecular formula | C29H29NO6 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]propanoic acid |
| InChIKey | XHBQLWKTRQMTPQ-VWLOTQADSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)