cas: 252049-08-4 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(((benzyloxy)carbonyl)amino)butanoic acid, 98% (CAS 252049-08-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F616761-5G |
| cas | 252049-08-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 815.36 Pln | |
| Fluorochem | 500g | 3845.54 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(phenylmethoxymethylamino)butanoic acid (CAS 252049-08-4) is a chemical compound with the molecular formula C27H28N2O5 and a molecular weight of 460.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(phenylmethoxymethylamino)butanoic acid. InChIKey: KKUPBFMKUPMFRE-VWLOTQADSA-N.
| Molecular formula | C27H28N2O5 |
|---|---|
| Molecular weight | 460.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(phenylmethoxymethylamino)butanoic acid |
| InChIKey | KKUPBFMKUPMFRE-VWLOTQADSA-N |
| SMILES | C1=CC=C(C=C1)COCNCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)