cas: 61278-30-6 — see every product listed under this CAS number, including other names
(S)-2-((2S,3R,4R)-3,4-Dihydroxy-5-oxotetrahydrofuran-2-yl)-2-hydroxyacetic acid hydrate, 95%, 95% (CAS 61278-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EDS1-100mg |
| cas | 61278-30-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1480.40 Pln | |
| Chemat | 50mg | 218.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate (CAS 61278-30-6) is a chemical compound with the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. IUPAC name: (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate. InChIKey: NPFKVZHSFSFLPU-QGBSHYGGSA-N.
| Molecular formula | C6H10O8 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate |
| InChIKey | NPFKVZHSFSFLPU-QGBSHYGGSA-N |
| SMILES | [C@H]1([C@H](C(=O)O[C@@H]1[C@@H](C(=O)O)O)O)O.O |
Computed by PubChem (NCBI)