Products 61278-30-6
CAS 61278-30-6 appears in our catalog under these names: D-Saccharic acid 1,4-lactone monohydrate, 95%, D-Glucaro-1,4-lactone Monohydrate, >95% (HPLC), D-Saccharic acid 1,4-lactone hydrate/ min. 98%, D–Saccharic Acid 1,4–lactone (hydrate), D-Glucaric acid-1,4-lactone. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 10mg, 25mg, 50mg, 100mg.
(2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate (CAS 61278-30-6) is a chemical compound with the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. IUPAC name: (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate. InChIKey: NPFKVZHSFSFLPU-QGBSHYGGSA-N.
| Molecular formula | C6H10O8 |
|---|---|
| Molecular weight | 210.14 g/mol |
| IUPAC name | (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate |
| InChIKey | NPFKVZHSFSFLPU-QGBSHYGGSA-N |
| SMILES | [C@H]1([C@H](C(=O)O[C@@H]1[C@@H](C(=O)O)O)O)O.O |
Computed by PubChem (NCBI)
Synonyms:
Npc488547, D-Saccharic acid 1,4-lactone monohydrate, d-glucaro-1,4-lactone monohydrate, D-Saccharic acid 1,4-lactone (hydrate), D-Saccharolactone, D-Glucaric acid-1,4-lactone, orb1303116, (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid hydrate, (2S)-2-[(2S,3R,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetic acid;hydrate, D-Glucaric acid, 1,4-lactone hydrate