CAS 100929-99-5 appears in our catalog under these names: PAβN 2HCl, 99%, PAβN dihydrochloride (MC–207,110 dihydrochloride), Phe-arg beta-naphthylamide dihydrochloride, 95%, Phe-Arg-b-naphthylamide Dihydrochloride, >95% (HPLC), Phe-Arg-Beta-naphthylamide Dihydrochloride, >95% (HPLC). Offered by: Ambeed, GLPBio, Combi-blocks, TRC, TargetMol. Available pack sizes: 250mg, 1g, 5mg, 100mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso).
2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)-N-naphthalen-2-ylpentanamide;hydrochloride (CAS 100929-99-5) is a chemical compound with the molecular formula C25H31ClN6O2 and a molecular weight of 483.0 g/mol. IUPAC name: 2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)-N-naphthalen-2-ylpentanamide;hydrochloride. InChIKey: ZMTAZQYLEGNUTJ-UHFFFAOYSA-N.
| Molecular formula | C25H31ClN6O2 |
|---|---|
| Molecular weight | 483.0 g/mol |
| IUPAC name | 2-[(2-amino-3-phenylpropanoyl)amino]-5-(diaminomethylideneamino)-N-naphthalen-2-ylpentanamide;hydrochloride |
| InChIKey | ZMTAZQYLEGNUTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NC(CCCN=C(N)N)C(=O)NC2=CC3=CC=CC=C3C=C2)N.Cl |
Computed by PubChem (NCBI)