Products 2891598-76-6
CAS 2891598-76-6 appears in our catalog under these names: Dalpiciclib (hydrochloride), 98.22%, Dalpiciclib (hydrochloride), 99%. Offered by: MedChemExpress, Chemat. Available pack sizes: 100 mg, 10 mg, 25 mg, 5 mg, 10mM/1mL, 50 mg, 1mg, 5mg.
6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperidin-4-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;hydrochloride (CAS 2891598-76-6) is a chemical compound with the molecular formula C25H31ClN6O2 and a molecular weight of 483.0 g/mol. IUPAC name: 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperidin-4-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;hydrochloride. InChIKey: HFUZGOIPADACLD-UHFFFAOYSA-N.
| Molecular formula | C25H31ClN6O2 |
|---|---|
| Molecular weight | 483.0 g/mol |
| IUPAC name | 6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperidin-4-yl-2-pyridinyl)amino]pyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| InChIKey | HFUZGOIPADACLD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)C4CCNCC4)C5CCCC5)C(=O)C.Cl |
Computed by PubChem (NCBI)