cas: 912444-01-0 — see every product listed under this CAS number, including other names
(S)-2-(2-Methylpyrrolidin-2-yl)-1h-benimidazole-4-carboxamide dihydrochloride, 95%, 95% (CAS 912444-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H25U-1g |
| cas | 912444-01-0 |
| size | 1g |
| availability | 53g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 39645.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide (CAS 912444-01-0) is a chemical compound with the molecular formula C13H16N4O and a molecular weight of 244.29 g/mol. IUPAC name: 2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide. InChIKey: JNAHVYVRKWKWKQ-ZDUSSCGKSA-N.
| Molecular formula | C13H16N4O |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide |
| InChIKey | JNAHVYVRKWKWKQ-ZDUSSCGKSA-N |
| SMILES | C[C@]1(CCCN1)C2=NC3=C(C=CC=C3N2)C(=O)N |
Computed by PubChem (NCBI)