CAS 912444-01-0 appears in our catalog under these names: (S)-2-(2-Methylpyrrolidin-2-yl)-1h-benimidazole-4-carboxamide dihydrochloride, 95%, (S)-2-(2-Methylpyrrolidin-2-yl)-1h-benimidazole-4-carboxamide dihydrochloride, 95%, 95%, PARP-2/1-IN-2. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5 mg, 100 mg, 10 mg, 50 mg, 25 mg.
2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide (CAS 912444-01-0) is a chemical compound with the molecular formula C13H16N4O and a molecular weight of 244.29 g/mol. IUPAC name: 2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide. InChIKey: JNAHVYVRKWKWKQ-ZDUSSCGKSA-N.
| Molecular formula | C13H16N4O |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole-4-carboxamide |
| InChIKey | JNAHVYVRKWKWKQ-ZDUSSCGKSA-N |
| SMILES | C[C@]1(CCCN1)C2=NC3=C(C=CC=C3N2)C(=O)N |
Computed by PubChem (NCBI)