(S)-2-(4-Bromophenyl)pyrrolidine, 95%
cas: 1189152-82-6 — see every product listed under this CAS number, including other names
(S)-2-(4-Bromophenyl)pyrrolidine, 95% (CAS 1189152-82-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A103534-250mg |
| cas | 1189152-82-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 486.52 Pln | |
| BLDpharm | 1g | 1441.74 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1494.80 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 768.50 Pln | |
| Fluorochem | 1g | 2778.21 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-(4-bromophenyl)pyrrolidine (CAS 1189152-82-6) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: (2S)-2-(4-bromophenyl)pyrrolidine. InChIKey: HIJZBROSVFKSCP-JTQLQIEISA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | (2S)-2-(4-bromophenyl)pyrrolidine |
| InChIKey | HIJZBROSVFKSCP-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)