CAS 1094218-30-0 appears in our catalog under these names: 1-(4-Bromophenyl)cyclobutanamine, 95%, 1-(4-Bromophenyl)cyclobutanamine, 98+%, 1-(4-Bromophenyl)cyclobutanamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-(4-bromophenyl)cyclobutan-1-amine (CAS 1094218-30-0) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: 1-(4-bromophenyl)cyclobutan-1-amine. InChIKey: JAINAWVWUDTCFK-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclobutan-1-amine |
| InChIKey | JAINAWVWUDTCFK-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)