CAS 55332-38-2 appears in our catalog under these names: (S)–2–(4–Chlorophenyl)–3–methylbutanoic acid, (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid, (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid, 95%, (S)-2-(4-Chlorophenyl)-3-methylbutanoic acid, 98%, (S)-2-(4-Chlorophenyl)-3-methylbutanoic Acid, >95% (HPLC). Offered by: GLPBio, Biosynth, HPC Standards, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 1x10mg, 5g, 50mg, 500mg.
(2S)-2-(4-chlorophenyl)-3-methylbutanoic acid (CAS 55332-38-2) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: (2S)-2-(4-chlorophenyl)-3-methylbutanoic acid. InChIKey: VTJMSIIXXKNIDJ-JTQLQIEISA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | (2S)-2-(4-chlorophenyl)-3-methylbutanoic acid |
| InChIKey | VTJMSIIXXKNIDJ-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)