CAS 1000341-32-1 appears in our catalog under these names: 3-Chloro-5-tert-butylbenzoic acid, 96%, 3-(tert-Butyl)-5-chlorobenzoic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-tert-butyl-5-chlorobenzoic acid (CAS 1000341-32-1) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: 3-tert-butyl-5-chlorobenzoic acid. InChIKey: XMGFILMCFURRSS-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-tert-butyl-5-chlorobenzoic acid |
| InChIKey | XMGFILMCFURRSS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)