cas: 146815-23-8 — see every product listed under this CAS number, including other names
(S)-2-(4-Nitrophenylsulfonamido)-3-phenylpropanoyl chloride, 95+% (CAS 146815-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A355504-1g |
| cas | 146815-23-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 636.37 Pln | |
| AmBeed | 10g | 3676.54 Pln | |
| AmBeed | 250mg | 512.68 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-[(4-nitrophenyl)sulfonylamino]-3-phenylpropanoyl chloride (CAS 146815-23-8) is a chemical compound with the molecular formula C15H13ClN2O5S and a molecular weight of 368.8 g/mol. IUPAC name: (2S)-2-[(4-nitrophenyl)sulfonylamino]-3-phenylpropanoyl chloride. InChIKey: RYQIQECSYJRDBT-AWEZNQCLSA-N.
| Molecular formula | C15H13ClN2O5S |
|---|---|
| Molecular weight | 368.8 g/mol |
| IUPAC name | (2S)-2-[(4-nitrophenyl)sulfonylamino]-3-phenylpropanoyl chloride |
| InChIKey | RYQIQECSYJRDBT-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)Cl)NS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)