CAS 146815-23-8 appears in our catalog under these names: N-(4-Nitrophenylsulfonyl)-l-phenylalanyl chloride, 95%, (S)-2-(4-Nitrophenylsulfonamido)-3-phenylpropanoyl chloride, 95+%, N–(4–Nitrophenylsulfonyl)–L–phenylalanyl Chloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg.
(2S)-2-[(4-nitrophenyl)sulfonylamino]-3-phenylpropanoyl chloride (CAS 146815-23-8) is a chemical compound with the molecular formula C15H13ClN2O5S and a molecular weight of 368.8 g/mol. IUPAC name: (2S)-2-[(4-nitrophenyl)sulfonylamino]-3-phenylpropanoyl chloride. InChIKey: RYQIQECSYJRDBT-AWEZNQCLSA-N.
| Molecular formula | C15H13ClN2O5S |
|---|---|
| Molecular weight | 368.8 g/mol |
| IUPAC name | (2S)-2-[(4-nitrophenyl)sulfonylamino]-3-phenylpropanoyl chloride |
| InChIKey | RYQIQECSYJRDBT-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)Cl)NS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)