(S)-2-(Fmoc-amino)-7-(Boc-amino)heptanoic Acid, 97%
cas: 194718-17-7 — see every product listed under this CAS number, including other names
(S)-2-(Fmoc-amino)-7-(Boc-amino)heptanoic Acid, 97% (CAS 194718-17-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APHK-50mg |
| cas | 194718-17-7 |
| size | 50mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 126.80 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1648.40 Pln | |
| Chemat | 25g | 2474.00 Pln | |
| Chemat | 50g | 4542.80 Pln | |
| Chemat | 250g | 20358.80 Pln | |
| Chemat | 500g | 29366.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid (CAS 194718-17-7) is a chemical compound with the molecular formula C27H34N2O6 and a molecular weight of 482.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid. InChIKey: CLFMIWUWBOOJLY-QHCPKHFHSA-N.
| Molecular formula | C27H34N2O6 |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
| InChIKey | CLFMIWUWBOOJLY-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)
