cas: 28529-34-2 — see every product listed under this CAS number, including other names
(S)-2-Acetamido-4-methylpentanamide, 95%, 95% (CAS 28529-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBUT-250mg |
| cas | 28529-34-2 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 299.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-acetamido-4-methylpentanamide (CAS 28529-34-2) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpentanamide. InChIKey: PHPXQAHAQREGGN-ZETCQYMHSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpentanamide |
| InChIKey | PHPXQAHAQREGGN-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N)NC(=O)C |
Computed by PubChem (NCBI)