CAS 28529-34-2 appears in our catalog under these names: (S)-2-Acetamido-4-methylpentanamide, 95%, 95%, Ac-leu-nh2, 98%, Ac–Leu–NH₂, Acetyl-L-leucine amide, Ac-Leu-NH2 95%. Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 1g, 10g, 5g, 25g, 50g.
(2S)-2-acetamido-4-methylpentanamide (CAS 28529-34-2) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpentanamide. InChIKey: PHPXQAHAQREGGN-ZETCQYMHSA-N.
| Molecular formula | C8H16N2O2 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpentanamide |
| InChIKey | PHPXQAHAQREGGN-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N)NC(=O)C |
Computed by PubChem (NCBI)